C12H23ClN4O — CID 114666035
2-[4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-1-(ethylamino)propan-2-ol (PubChem CID 114666035) has the molecular formula C12H23ClN4O and a molecular weight of 274.80 g/mol. Its IUPAC name is 2-[4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-1-(ethylamino)propan-2-ol.
| Compound Name | 2-[4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-1-(ethylamino)propan-2-ol |
|---|---|
| PubChem CID | 114666035 |
| Molecular Formula | C12H23ClN4O |
| Molecular Weight | 274.80 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | 2-[4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-1-(ethylamino)propan-2-ol |
| SMILES | CCNCC(C)(O)c1c(Cl)cnn1CCN(C)C |
| InChI | InChI=1S/C12H23ClN4O/c1-5-14-9-12(2,18)11-10(13)8-15-17(11)7-6-16(3)4/h8,14,18H,5-7,9H2,1-4H3 |
| InChIKey | SUFJFXSLEKZCQH-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.80 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |