C13H24ClN3O2 — CID 114666096
1-(tert-butylamino)-2-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]propan-2-ol (PubChem CID 114666096) has the molecular formula C13H24ClN3O2 and a molecular weight of 289.81 g/mol. Its IUPAC name is 1-(tert-butylamino)-2-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]propan-2-ol.
| Compound Name | 1-(tert-butylamino)-2-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]propan-2-ol |
|---|---|
| PubChem CID | 114666096 |
| Molecular Formula | C13H24ClN3O2 |
| Molecular Weight | 289.81 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | 1-(tert-butylamino)-2-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]propan-2-ol |
| SMILES | COCCn1ncc(Cl)c1C(C)(O)CNC(C)(C)C |
| InChI | InChI=1S/C13H24ClN3O2/c1-12(2,3)15-9-13(4,18)11-10(14)8-16-17(11)6-7-19-5/h8,15,18H,6-7,9H2,1-5H3 |
| InChIKey | AVWBGAALXOUVSA-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.81 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |