C12H22BrN3O3 — CID 114636618
2-[4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-1,1-dimethoxypropan-2-ol (PubChem CID 114636618) has the molecular formula C12H22BrN3O3 and a molecular weight of 336.23 g/mol. Its IUPAC name is 2-[4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-1,1-dimethoxypropan-2-ol.
| Compound Name | 2-[4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-1,1-dimethoxypropan-2-ol |
|---|---|
| PubChem CID | 114636618 |
| Molecular Formula | C12H22BrN3O3 |
| Molecular Weight | 336.23 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | 2-[4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-1,1-dimethoxypropan-2-ol |
| SMILES | COC(OC)C(C)(O)c1c(Br)cnn1CCN(C)C |
| InChI | InChI=1S/C12H22BrN3O3/c1-12(17,11(18-4)19-5)10-9(13)8-14-16(10)7-6-15(2)3/h8,11,17H,6-7H2,1-5H3 |
| InChIKey | RFVBVMRRHIBSHT-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 59.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.23 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|