C13H18BrN3O3 — CID 114634300
(5-bromofuran-2-yl)-[1-[2-(dimethylamino)ethyl]-4-methoxypyrazol-5-yl]methanol (PubChem CID 114634300) has the molecular formula C13H18BrN3O3 and a molecular weight of 344.21 g/mol. Its IUPAC name is (5-bromofuran-2-yl)-[1-[2-(dimethylamino)ethyl]-4-methoxypyrazol-5-yl]methanol.
| Compound Name | (5-bromofuran-2-yl)-[1-[2-(dimethylamino)ethyl]-4-methoxypyrazol-5-yl]methanol |
|---|---|
| PubChem CID | 114634300 |
| Molecular Formula | C13H18BrN3O3 |
| Molecular Weight | 344.21 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | (5-bromofuran-2-yl)-[1-[2-(dimethylamino)ethyl]-4-methoxypyrazol-5-yl]methanol |
| SMILES | COc1cnn(CCN(C)C)c1C(O)c1ccc(Br)o1 |
| InChI | InChI=1S/C13H18BrN3O3/c1-16(2)6-7-17-12(10(19-3)8-15-17)13(18)9-4-5-11(14)20-9/h4-5,8,13,18H,6-7H2,1-3H3 |
| InChIKey | IHRMDPRPXNSFSE-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 63.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.21 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |