C13H19N5O2 — CID 114643046
[1-[2-(dimethylamino)ethyl]-4-methoxypyrazol-5-yl]-pyrimidin-2-ylmethanol (PubChem CID 114643046) has the molecular formula C13H19N5O2 and a molecular weight of 277.33 g/mol. Its IUPAC name is [1-[2-(dimethylamino)ethyl]-4-methoxypyrazol-5-yl]-pyrimidin-2-ylmethanol.
| Compound Name | [1-[2-(dimethylamino)ethyl]-4-methoxypyrazol-5-yl]-pyrimidin-2-ylmethanol |
|---|---|
| PubChem CID | 114643046 |
| Molecular Formula | C13H19N5O2 |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | [1-[2-(dimethylamino)ethyl]-4-methoxypyrazol-5-yl]-pyrimidin-2-ylmethanol |
| SMILES | COc1cnn(CCN(C)C)c1C(O)c1ncccn1 |
| InChI | InChI=1S/C13H19N5O2/c1-17(2)7-8-18-11(10(20-3)9-16-18)12(19)13-14-5-4-6-15-13/h4-6,9,12,19H,7-8H2,1-3H3 |
| InChIKey | XBCTWYLTTRRVEU-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |