C13H18BrN3O2S — CID 114643699
(4-bromothiophen-2-yl)-[1-[2-(dimethylamino)ethyl]-4-methoxypyrazol-5-yl]methanol (PubChem CID 114643699) has the molecular formula C13H18BrN3O2S and a molecular weight of 360.28 g/mol. Its IUPAC name is (4-bromothiophen-2-yl)-[1-[2-(dimethylamino)ethyl]-4-methoxypyrazol-5-yl]methanol.
| Compound Name | (4-bromothiophen-2-yl)-[1-[2-(dimethylamino)ethyl]-4-methoxypyrazol-5-yl]methanol |
|---|---|
| PubChem CID | 114643699 |
| Molecular Formula | C13H18BrN3O2S |
| Molecular Weight | 360.28 g/mol |
| Exact Mass | 359.03 |
| IUPAC Name | (4-bromothiophen-2-yl)-[1-[2-(dimethylamino)ethyl]-4-methoxypyrazol-5-yl]methanol |
| SMILES | COc1cnn(CCN(C)C)c1C(O)c1cc(Br)cs1 |
| InChI | InChI=1S/C13H18BrN3O2S/c1-16(2)4-5-17-12(10(19-3)7-15-17)13(18)11-6-9(14)8-20-11/h6-8,13,18H,4-5H2,1-3H3 |
| InChIKey | UVUSFAMVCHHDHN-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.28 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |