C15H16N2O2S — CID 114635146
1-benzothiophen-3-yl-(1-ethyl-4-methoxypyrazol-5-yl)methanol (PubChem CID 114635146) has the molecular formula C15H16N2O2S and a molecular weight of 288.37 g/mol. Its IUPAC name is 1-benzothiophen-3-yl-(1-ethyl-4-methoxypyrazol-5-yl)methanol.
| Compound Name | 1-benzothiophen-3-yl-(1-ethyl-4-methoxypyrazol-5-yl)methanol |
|---|---|
| PubChem CID | 114635146 |
| Molecular Formula | C15H16N2O2S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 1-benzothiophen-3-yl-(1-ethyl-4-methoxypyrazol-5-yl)methanol |
| SMILES | CCn1ncc(OC)c1C(O)c1csc2ccccc12 |
| InChI | InChI=1S/C15H16N2O2S/c1-3-17-14(12(19-2)8-16-17)15(18)11-9-20-13-7-5-4-6-10(11)13/h4-9,15,18H,3H2,1-2H3 |
| InChIKey | PMVNOMPKVRFLOH-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |