C18H19FINO — CID 11464035
2-(4-fluorophenyl)-1-(2-iodoethyl)-6,6-dimethyl-5,7-dihydroindol-4-one (PubChem CID 11464035) has the molecular formula C18H19FINO and a molecular weight of 411.26 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-1-(2-iodoethyl)-6,6-dimethyl-5,7-dihydroindol-4-one.
| Compound Name | 2-(4-fluorophenyl)-1-(2-iodoethyl)-6,6-dimethyl-5,7-dihydroindol-4-one |
|---|---|
| PubChem CID | 11464035 |
| Molecular Formula | C18H19FINO |
| Molecular Weight | 411.26 g/mol |
| Exact Mass | 411.05 |
| IUPAC Name | 2-(4-fluorophenyl)-1-(2-iodoethyl)-6,6-dimethyl-5,7-dihydroindol-4-one |
| SMILES | CC1(C)CC(=O)c2cc(-c3ccc(F)cc3)n(CCI)c2C1 |
| InChI | InChI=1S/C18H19FINO/c1-18(2)10-16-14(17(22)11-18)9-15(21(16)8-7-20)12-3-5-13(19)6-4-12/h3-6,9H,7-8,10-11H2,1-2H3 |
| InChIKey | YUPOOOMYQBAFNH-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.26 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|