C16H28ClN3O — CID 114644534
(4-chloro-1-propylpyrazol-5-yl)-[1-(diethylamino)cyclopentyl]methanol (PubChem CID 114644534) has the molecular formula C16H28ClN3O and a molecular weight of 313.87 g/mol. Its IUPAC name is (4-chloro-1-propylpyrazol-5-yl)-[1-(diethylamino)cyclopentyl]methanol.
| Compound Name | (4-chloro-1-propylpyrazol-5-yl)-[1-(diethylamino)cyclopentyl]methanol |
|---|---|
| PubChem CID | 114644534 |
| Molecular Formula | C16H28ClN3O |
| Molecular Weight | 313.87 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | (4-chloro-1-propylpyrazol-5-yl)-[1-(diethylamino)cyclopentyl]methanol |
| SMILES | CCCn1ncc(Cl)c1C(O)C1(N(CC)CC)CCCC1 |
| InChI | InChI=1S/C16H28ClN3O/c1-4-11-20-14(13(17)12-18-20)15(21)16(9-7-8-10-16)19(5-2)6-3/h12,15,21H,4-11H2,1-3H3 |
| InChIKey | ZAPGHSHWDARDQO-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.87 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |