C20H34O2S2Si2 — CID 11464479
(1,6-dithiophen-2-yl-6-trimethylsilyloxyhexoxy)-trimethylsilane (PubChem CID 11464479) has the molecular formula C20H34O2S2Si2 and a molecular weight of 426.80 g/mol. Its IUPAC name is (1,6-dithiophen-2-yl-6-trimethylsilyloxyhexoxy)-trimethylsilane.
| Compound Name | (1,6-dithiophen-2-yl-6-trimethylsilyloxyhexoxy)-trimethylsilane |
|---|---|
| PubChem CID | 11464479 |
| Molecular Formula | C20H34O2S2Si2 |
| Molecular Weight | 426.80 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | (1,6-dithiophen-2-yl-6-trimethylsilyloxyhexoxy)-trimethylsilane |
| SMILES | C[Si](C)(C)OC(CCCCC(O[Si](C)(C)C)c1cccs1)c1cccs1 |
| InChI | InChI=1S/C20H34O2S2Si2/c1-25(2,3)21-17(19-13-9-15-23-19)11-7-8-12-18(22-26(4,5)6)20-14-10-16-24-20/h9-10,13-18H,7-8,11-12H2,1-6H3 |
| InChIKey | OUMNVXRUYLDOOF-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.80 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|