C18H25N3O9S — CID 11465308
(2R,3R,4S,5R,6R)-2-[(2R,3S,4R,5R,6S)-5-azido-3-hydroxy-2-(hydroxymethyl)-6-phenylsulfanyloxan-4-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 11465308) has the molecular formula C18H25N3O9S and a molecular weight of 459.48 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-2-[(2R,3S,4R,5R,6S)-5-azido-3-hydroxy-2-(hydroxymethyl)-6-phenylsulfanyloxan-4-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5R,6R)-2-[(2R,3S,4R,5R,6S)-5-azido-3-hydroxy-2-(hydroxymethyl)-6-phenylsulfanyloxan-4-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 11465308 |
| Molecular Formula | C18H25N3O9S |
| Molecular Weight | 459.48 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | (2R,3R,4S,5R,6R)-2-[(2R,3S,4R,5R,6S)-5-azido-3-hydroxy-2-(hydroxymethyl)-6-phenylsulfanyloxan-4-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | [N-]=[N+]=N[C@@H]1[C@@H](O[C@@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](CO)O[C@H]1Sc1ccccc1 |
| InChI | InChI=1S/C18H25N3O9S/c19-21-20-11-16(30-17-15(27)14(26)12(24)9(6-22)28-17)13(25)10(7-23)29-18(11)31-8-4-2-1-3-5-8/h1-5,9-18,22-27H,6-7H2/t9-,10-,11-,12+,13-,14+,15-,16-,17+,18+/m1/s1 |
| InChIKey | YPPGJZCCIWIVTR-OTAZAQKZSA-N |
| XLogP | -1.28 |
| TPSA | 197.83 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.48 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|