C26H42FN3O9SSi — CID 138966127
(2S,5R)-2-[(3S,6R)-6-azido-2-[[4-[ditert-butyl(fluoro)silyl]phenyl]sulfanylmethyl]-4,5-dihydroxyoxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 138966127) has the molecular formula C26H42FN3O9SSi and a molecular weight of 619.79 g/mol. Its IUPAC name is (2S,5R)-2-[(3S,6R)-6-azido-2-[[4-[ditert-butyl(fluoro)silyl]phenyl]sulfanylmethyl]-4,5-dihydroxyoxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,5R)-2-[(3S,6R)-6-azido-2-[[4-[ditert-butyl(fluoro)silyl]phenyl]sulfanylmethyl]-4,5-dihydroxyoxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 138966127 |
| Molecular Formula | C26H42FN3O9SSi |
| Molecular Weight | 619.79 g/mol |
| Exact Mass | 619.24 |
| IUPAC Name | (2S,5R)-2-[(3S,6R)-6-azido-2-[[4-[ditert-butyl(fluoro)silyl]phenyl]sulfanylmethyl]-4,5-dihydroxyoxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CC(C)(C)[Si](F)(c1ccc(SCC2O[C@@H](N=[N+]=[N-])C(O)C(O)[C@@H]2O[C@@H]2OC(CO)[C@H](O)C(O)C2O)cc1)C(C)(C)C |
| InChI | InChI=1S/C26H42FN3O9SSi/c1-25(2,3)41(27,26(4,5)6)14-9-7-13(8-10-14)40-12-16-22(19(34)20(35)23(37-16)29-30-28)39-24-21(36)18(33)17(32)15(11-31)38-24/h7-10,15-24,31-36H,11-12H2,1-6H3/t15?,16?,17-,18?,19?,20?,21?,22+,23+,24-/m0/s1 |
| InChIKey | LFGLBXNGOMAOPS-SFUFPBRZSA-N |
| XLogP | 1.44 |
| TPSA | 197.83 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.79 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|