C20H32FN3O4SSi — CID 138966129
(2R,5S)-2-azido-6-[[4-[ditert-butyl(fluoro)silyl]phenyl]sulfanylmethyl]oxane-3,4,5-triol (PubChem CID 138966129) has the molecular formula C20H32FN3O4SSi and a molecular weight of 457.64 g/mol. Its IUPAC name is (2R,5S)-2-azido-6-[[4-[ditert-butyl(fluoro)silyl]phenyl]sulfanylmethyl]oxane-3,4,5-triol.
| Compound Name | (2R,5S)-2-azido-6-[[4-[ditert-butyl(fluoro)silyl]phenyl]sulfanylmethyl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 138966129 |
| Molecular Formula | C20H32FN3O4SSi |
| Molecular Weight | 457.64 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | (2R,5S)-2-azido-6-[[4-[ditert-butyl(fluoro)silyl]phenyl]sulfanylmethyl]oxane-3,4,5-triol |
| SMILES | CC(C)(C)[Si](F)(c1ccc(SCC2O[C@@H](N=[N+]=[N-])C(O)C(O)[C@@H]2O)cc1)C(C)(C)C |
| InChI | InChI=1S/C20H32FN3O4SSi/c1-19(2,3)30(21,20(4,5)6)13-9-7-12(8-10-13)29-11-14-15(25)16(26)17(27)18(28-14)23-24-22/h7-10,14-18,25-27H,11H2,1-6H3/t14?,15-,16?,17?,18-/m1/s1 |
| InChIKey | FYBMUNCBZTVDDG-QOGDJRHHSA-N |
| XLogP | 3.62 |
| TPSA | 118.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.64 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|