C19H28N4O7S — CID 20677819
6-(4-amino-5-methoxy-6-methyl-2-phenylsulfanyloxan-3-yl)oxy-5-azido-2-(hydroxymethyl)oxane-3,4-diol (PubChem CID 20677819) has the molecular formula C19H28N4O7S and a molecular weight of 456.52 g/mol. Its IUPAC name is 6-(4-amino-5-methoxy-6-methyl-2-phenylsulfanyloxan-3-yl)oxy-5-azido-2-(hydroxymethyl)oxane-3,4-diol.
| Compound Name | 6-(4-amino-5-methoxy-6-methyl-2-phenylsulfanyloxan-3-yl)oxy-5-azido-2-(hydroxymethyl)oxane-3,4-diol |
|---|---|
| PubChem CID | 20677819 |
| Molecular Formula | C19H28N4O7S |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | 6-(4-amino-5-methoxy-6-methyl-2-phenylsulfanyloxan-3-yl)oxy-5-azido-2-(hydroxymethyl)oxane-3,4-diol |
| SMILES | COC1C(C)OC(Sc2ccccc2)C(OC2OC(CO)C(O)C(O)C2N=[N+]=[N-])C1N |
| InChI | InChI=1S/C19H28N4O7S/c1-9-16(27-2)12(20)17(19(28-9)31-10-6-4-3-5-7-10)30-18-13(22-23-21)15(26)14(25)11(8-24)29-18/h3-7,9,11-19,24-26H,8,20H2,1-2H3 |
| InChIKey | NFSOIVXQKXQLHE-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 172.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|