C24H39N3O6SSi — CID 66554367
[(2S,3S,4aR,5R,7R,8S,8aS)-5-(azidomethyl)-2,3-dimethoxy-2,3-dimethyl-7-phenylsulfanyl-5,7,8,8a-tetrahydro-4aH-pyrano[3,4-b][1,4]dioxin-8-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 66554367) has the molecular formula C24H39N3O6SSi and a molecular weight of 525.74 g/mol. Its IUPAC name is [(2S,3S,4aR,5R,7R,8S,8aS)-5-(azidomethyl)-2,3-dimethoxy-2,3-dimethyl-7-phenylsulfanyl-5,7,8,8a-tetrahydro-4aH-pyrano[3,4-b][1,4]dioxin-8-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(2S,3S,4aR,5R,7R,8S,8aS)-5-(azidomethyl)-2,3-dimethoxy-2,3-dimethyl-7-phenylsulfanyl-5,7,8,8a-tetrahydro-4aH-pyrano[3,4-b][1,4]dioxin-8-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 66554367 |
| Molecular Formula | C24H39N3O6SSi |
| Molecular Weight | 525.74 g/mol |
| Exact Mass | 525.23 |
| IUPAC Name | [(2S,3S,4aR,5R,7R,8S,8aS)-5-(azidomethyl)-2,3-dimethoxy-2,3-dimethyl-7-phenylsulfanyl-5,7,8,8a-tetrahydro-4aH-pyrano[3,4-b][1,4]dioxin-8-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CO[C@@]1(C)O[C@@H]2[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](Sc3ccccc3)O[C@H](CN=[N+]=[N-])[C@H]2O[C@]1(C)OC |
| InChI | InChI=1S/C24H39N3O6SSi/c1-22(2,3)35(8,9)33-20-19-18(31-23(4,28-6)24(5,29-7)32-19)17(15-26-27-25)30-21(20)34-16-13-11-10-12-14-16/h10-14,17-21H,15H2,1-9H3/t17-,18-,19+,20+,21-,23+,24+/m1/s1 |
| InChIKey | DQKAHCRPISTJQR-CAUAKYCLSA-N |
| XLogP | 5.71 |
| TPSA | 104.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.74 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|