C18H25N3O6S — CID 66554311
(2S,3S,4aR,5R,7R,8S,8aR)-5-(azidomethyl)-2,3-dimethoxy-2,3-dimethyl-7-phenylsulfanyl-5,7,8,8a-tetrahydro-4aH-pyrano[3,4-b][1,4]dioxin-8-ol (PubChem CID 66554311) has the molecular formula C18H25N3O6S and a molecular weight of 411.48 g/mol. Its IUPAC name is (2S,3S,4aR,5R,7R,8S,8aR)-5-(azidomethyl)-2,3-dimethoxy-2,3-dimethyl-7-phenylsulfanyl-5,7,8,8a-tetrahydro-4aH-pyrano[3,4-b][1,4]dioxin-8-ol.
| Compound Name | (2S,3S,4aR,5R,7R,8S,8aR)-5-(azidomethyl)-2,3-dimethoxy-2,3-dimethyl-7-phenylsulfanyl-5,7,8,8a-tetrahydro-4aH-pyrano[3,4-b][1,4]dioxin-8-ol |
|---|---|
| PubChem CID | 66554311 |
| Molecular Formula | C18H25N3O6S |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | (2S,3S,4aR,5R,7R,8S,8aR)-5-(azidomethyl)-2,3-dimethoxy-2,3-dimethyl-7-phenylsulfanyl-5,7,8,8a-tetrahydro-4aH-pyrano[3,4-b][1,4]dioxin-8-ol |
| SMILES | CO[C@@]1(C)O[C@@H]2[C@H](O)[C@@H](Sc3ccccc3)O[C@H](CN=[N+]=[N-])[C@H]2O[C@]1(C)OC |
| InChI | InChI=1S/C18H25N3O6S/c1-17(23-3)18(2,24-4)27-15-13(22)16(28-11-8-6-5-7-9-11)25-12(10-20-21-19)14(15)26-17/h5-9,12-16,22H,10H2,1-4H3/t12-,13+,14-,15-,16-,17+,18+/m1/s1 |
| InChIKey | SVDJAQJMWBHLAN-CTISPVFFSA-N |
| XLogP | 2.68 |
| TPSA | 115.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|