C28H35N3O14S — CID 10876119
[(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[(2R,3S,4R,5R,6R)-2-(acetyloxymethyl)-5-azido-4-hydroxy-6-phenylsulfanyloxan-3-yl]oxyoxan-2-yl]methyl acetate (PubChem CID 10876119) has the molecular formula C28H35N3O14S and a molecular weight of 669.66 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[(2R,3S,4R,5R,6R)-2-(acetyloxymethyl)-5-azido-4-hydroxy-6-phenylsulfanyloxan-3-yl]oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[(2R,3S,4R,5R,6R)-2-(acetyloxymethyl)-5-azido-4-hydroxy-6-phenylsulfanyloxan-3-yl]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10876119 |
| Molecular Formula | C28H35N3O14S |
| Molecular Weight | 669.66 g/mol |
| Exact Mass | 669.18 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[(2R,3S,4R,5R,6R)-2-(acetyloxymethyl)-5-azido-4-hydroxy-6-phenylsulfanyloxan-3-yl]oxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](N=[N+]=[N-])[C@@H](Sc3ccccc3)O[C@@H]2COC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C28H35N3O14S/c1-13(32)38-11-19-23(22(37)21(30-31-29)28(44-19)46-18-9-7-6-8-10-18)45-27-26(42-17(5)36)25(41-16(4)35)24(40-15(3)34)20(43-27)12-39-14(2)33/h6-10,19-28,37H,11-12H2,1-5H3/t19-,20-,21-,22-,23-,24+,25+,26-,27+,28-/m1/s1 |
| InChIKey | FITZTFJUZKAYAM-PQTXMOTQSA-N |
| XLogP | 1.57 |
| TPSA | 228.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.66 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|