C13H23ClN4O — CID 114668566
2-amino-1-[4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-2-methylpentan-1-one (PubChem CID 114668566) has the molecular formula C13H23ClN4O and a molecular weight of 286.81 g/mol. Its IUPAC name is 2-amino-1-[4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-2-methylpentan-1-one.
| Compound Name | 2-amino-1-[4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-2-methylpentan-1-one |
|---|---|
| PubChem CID | 114668566 |
| Molecular Formula | C13H23ClN4O |
| Molecular Weight | 286.81 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | 2-amino-1-[4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-2-methylpentan-1-one |
| SMILES | CCCC(C)(N)C(=O)c1c(Cl)cnn1CCN(C)C |
| InChI | InChI=1S/C13H23ClN4O/c1-5-6-13(2,15)12(19)11-10(14)9-16-18(11)8-7-17(3)4/h9H,5-8,15H2,1-4H3 |
| InChIKey | AGKGYVLNPQDECP-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.81 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |