C11H15ClN6O2 — CID 114670644
2-[4-(aminomethyl)triazol-1-yl]-1-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]ethanone (PubChem CID 114670644) has the molecular formula C11H15ClN6O2 and a molecular weight of 298.73 g/mol. Its IUPAC name is 2-[4-(aminomethyl)triazol-1-yl]-1-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]ethanone.
| Compound Name | 2-[4-(aminomethyl)triazol-1-yl]-1-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]ethanone |
|---|---|
| PubChem CID | 114670644 |
| Molecular Formula | C11H15ClN6O2 |
| Molecular Weight | 298.73 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 2-[4-(aminomethyl)triazol-1-yl]-1-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]ethanone |
| SMILES | COCCn1ncc(Cl)c1C(=O)Cn1cc(CN)nn1 |
| InChI | InChI=1S/C11H15ClN6O2/c1-20-3-2-18-11(9(12)5-14-18)10(19)7-17-6-8(4-13)15-16-17/h5-6H,2-4,7,13H2,1H3 |
| InChIKey | CKVLPCWSMRAYCG-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 100.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.73 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |