C16H18N2O3 — CID 114672575
7-methoxy-2-(3-propylimidazol-4-yl)-2,3-dihydrochromen-4-one (PubChem CID 114672575) has the molecular formula C16H18N2O3 and a molecular weight of 286.33 g/mol. Its IUPAC name is 7-methoxy-2-(3-propylimidazol-4-yl)-2,3-dihydrochromen-4-one.
| Compound Name | 7-methoxy-2-(3-propylimidazol-4-yl)-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 114672575 |
| Molecular Formula | C16H18N2O3 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 7-methoxy-2-(3-propylimidazol-4-yl)-2,3-dihydrochromen-4-one |
| SMILES | CCCn1cncc1C1CC(=O)c2ccc(OC)cc2O1 |
| InChI | InChI=1S/C16H18N2O3/c1-3-6-18-10-17-9-13(18)16-8-14(19)12-5-4-11(20-2)7-15(12)21-16/h4-5,7,9-10,16H,3,6,8H2,1-2H3 |
| InChIKey | MLRYGYFKLLDSLG-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |