C15H17ClO2 — CID 114673009
6-chloro-2'-ethylspiro[3H-chromene-2,1'-cyclopentane]-4-one (PubChem CID 114673009) has the molecular formula C15H17ClO2 and a molecular weight of 264.75 g/mol. Its IUPAC name is 6-chloro-2'-ethylspiro[3H-chromene-2,1'-cyclopentane]-4-one.
| Compound Name | 6-chloro-2'-ethylspiro[3H-chromene-2,1'-cyclopentane]-4-one |
|---|---|
| PubChem CID | 114673009 |
| Molecular Formula | C15H17ClO2 |
| Molecular Weight | 264.75 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 6-chloro-2'-ethylspiro[3H-chromene-2,1'-cyclopentane]-4-one |
| SMILES | CCC1CCCC12CC(=O)c1cc(Cl)ccc1O2 |
| InChI | InChI=1S/C15H17ClO2/c1-2-10-4-3-7-15(10)9-13(17)12-8-11(16)5-6-14(12)18-15/h5-6,8,10H,2-4,7,9H2,1H3 |
| InChIKey | CYHFTUMEUIPHLC-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.75 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |