About 7-bromo-2'-ethylspiro[3H-chromene-2,1'-cyclohexane]-4-one
7-bromo-2'-ethylspiro[3H-chromene-2,1'-cyclohexane]-4-one (PubChem CID 114673264) has the molecular formula C16H19BrO2
and a molecular weight of 323.23 g/mol. Its IUPAC name is 7-bromo-2'-ethylspiro[3H-chromene-2,1'-cyclohexane]-4-one.
Molecular Properties
| Compound Name | 7-bromo-2'-ethylspiro[3H-chromene-2,1'-cyclohexane]-4-one |
| PubChem CID | 114673264 |
| Molecular Formula | C16H19BrO2 |
| Molecular Weight | 323.23 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | 7-bromo-2'-ethylspiro[3H-chromene-2,1'-cyclohexane]-4-one |
| SMILES | CCC1CCCCC12CC(=O)c1ccc(Br)cc1O2 |
| InChI | InChI=1S/C16H19BrO2/c1-2-11-5-3-4-8-16(11)10-14(18)13-7-6-12(17)9-15(13)19-16/h6-7,9,11H,2-5,8,10H2,1H3 |
| InChIKey | RXMXTCQKZWFPMY-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.23 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-bromo-2'-ethylspiro[3H-chromene-2,1'-cyclohexane]-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-2'-ethylspiro[3H-chromene-2,1'-cyclohexane]-4-one?
The IUPAC name of 7-bromo-2'-ethylspiro[3H-chromene-2,1'-cyclohexane]-4-one (CID 114673264) is 7-bromo-2'-ethylspiro[3H-chromene-2,1'-cyclohexane]-4-one.
What is the SMILES notation for 7-bromo-2'-ethylspiro[3H-chromene-2,1'-cyclohexane]-4-one?
The canonical SMILES for 7-bromo-2'-ethylspiro[3H-chromene-2,1'-cyclohexane]-4-one is CCC1CCCCC12CC(=O)c1ccc(Br)cc1O2.
What is the InChIKey of 7-bromo-2'-ethylspiro[3H-chromene-2,1'-cyclohexane]-4-one?
The InChIKey is RXMXTCQKZWFPMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19BrO2/c1-2-11-5-3-4-8-16(11)10-14(18)13-7-6-12(17)9-15(13)19-16/h6-7,9,11H,2-5,8,10H2,1H3.
What are the key properties of 7-bromo-2'-ethylspiro[3H-chromene-2,1'-cyclohexane]-4-one?
7-bromo-2'-ethylspiro[3H-chromene-2,1'-cyclohexane]-4-one has a molecular weight of 323.23 g/mol, XLogP of 4.75, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-2'-ethylspiro[3H-chromene-2,1'-cyclohexane]-4-one is sourced from PubChem (CID 114673264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).