C8H12ClN3O2 — CID 114676261
5-chloro-4-[2-(dimethylamino)ethoxy]-1H-pyrimidin-6-one (PubChem CID 114676261) has the molecular formula C8H12ClN3O2 and a molecular weight of 217.66 g/mol. Its IUPAC name is 5-chloro-4-[2-(dimethylamino)ethoxy]-1H-pyrimidin-6-one.
| Compound Name | 5-chloro-4-[2-(dimethylamino)ethoxy]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 114676261 |
| Molecular Formula | C8H12ClN3O2 |
| Molecular Weight | 217.66 g/mol |
| Exact Mass | 217.06 |
| IUPAC Name | 5-chloro-4-[2-(dimethylamino)ethoxy]-1H-pyrimidin-6-one |
| SMILES | CN(C)CCOc1nc[nH]c(=O)c1Cl |
| InChI | InChI=1S/C8H12ClN3O2/c1-12(2)3-4-14-8-6(9)7(13)10-5-11-8/h5H,3-4H2,1-2H3,(H,10,11,13) |
| InChIKey | WRBYQOGDLZQINQ-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.66 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |