C9H15N3O3 — CID 103241380
4-[2-(dimethylamino)ethoxy]-5-methoxy-1H-pyrimidin-6-one (PubChem CID 103241380) has the molecular formula C9H15N3O3 and a molecular weight of 213.24 g/mol. Its IUPAC name is 4-[2-(dimethylamino)ethoxy]-5-methoxy-1H-pyrimidin-6-one.
| Compound Name | 4-[2-(dimethylamino)ethoxy]-5-methoxy-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 103241380 |
| Molecular Formula | C9H15N3O3 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.11 |
| IUPAC Name | 4-[2-(dimethylamino)ethoxy]-5-methoxy-1H-pyrimidin-6-one |
| SMILES | COc1c(OCCN(C)C)nc[nH]c1=O |
| InChI | InChI=1S/C9H15N3O3/c1-12(2)4-5-15-9-7(14-3)8(13)10-6-11-9/h6H,4-5H2,1-3H3,(H,10,11,13) |
| InChIKey | HPLRZBKHGOPCOX-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |