C8H17N5O — CID 114679013
N-(diaminomethylidene)-4-hydroxy-3-methylpiperidine-1-carboximidamide (PubChem CID 114679013) has the molecular formula C8H17N5O and a molecular weight of 199.26 g/mol. Its IUPAC name is N-(diaminomethylidene)-4-hydroxy-3-methylpiperidine-1-carboximidamide.
| Compound Name | N-(diaminomethylidene)-4-hydroxy-3-methylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 114679013 |
| Molecular Formula | C8H17N5O |
| Molecular Weight | 199.26 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | N-(diaminomethylidene)-4-hydroxy-3-methylpiperidine-1-carboximidamide |
| SMILES | [H]/N=C(\N=C(N)N)N1CCC(O)C(C)C1 |
| InChI | InChI=1S/C8H17N5O/c1-5-4-13(3-2-6(5)14)8(11)12-7(9)10/h5-6,14H,2-4H2,1H3,(H5,9,10,11,12) |
| InChIKey | FNIGZVAAHFAYRO-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 111.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.26 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|