C12H25N7 — CID 123226101
4-amino-N'-(4-aminopiperidine-1-carboximidoyl)piperidine-1-carboximidamide (PubChem CID 123226101) has the molecular formula C12H25N7 and a molecular weight of 267.38 g/mol. Its IUPAC name is 4-amino-N'-(4-aminopiperidine-1-carboximidoyl)piperidine-1-carboximidamide.
| Compound Name | 4-amino-N'-(4-aminopiperidine-1-carboximidoyl)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 123226101 |
| Molecular Formula | C12H25N7 |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.22 |
| IUPAC Name | 4-amino-N'-(4-aminopiperidine-1-carboximidoyl)piperidine-1-carboximidamide |
| SMILES | [H]/N=C(/N=C(N)N1CCC(N)CC1)N1CCC(N)CC1 |
| InChI | InChI=1S/C12H25N7/c13-9-1-5-18(6-2-9)11(15)17-12(16)19-7-3-10(14)4-8-19/h9-10H,1-8,13-14H2,(H3,15,16,17) |
| InChIKey | PXORHDVTMWOJLZ-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|