C8H15N5 — CID 114689941
1-(3-methyltriazol-4-yl)-1,4-diazepane (PubChem CID 114689941) has the molecular formula C8H15N5 and a molecular weight of 181.24 g/mol. Its IUPAC name is 1-(3-methyltriazol-4-yl)-1,4-diazepane.
| Compound Name | 1-(3-methyltriazol-4-yl)-1,4-diazepane |
|---|---|
| PubChem CID | 114689941 |
| Molecular Formula | C8H15N5 |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.13 |
| IUPAC Name | 1-(3-methyltriazol-4-yl)-1,4-diazepane |
| SMILES | Cn1nncc1N1CCCNCC1 |
| InChI | InChI=1S/C8H15N5/c1-12-8(7-10-11-12)13-5-2-3-9-4-6-13/h7,9H,2-6H2,1H3 |
| InChIKey | IASXXALCZBMCQL-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |