C14H23N5 — CID 144746657
7-(1,4-diazepan-1-yl)-1-methyl-2,3,4,5-tetrahydropyrido[2,3-b][1,4]diazepine (PubChem CID 144746657) has the molecular formula C14H23N5 and a molecular weight of 261.37 g/mol. Its IUPAC name is 7-(1,4-diazepan-1-yl)-1-methyl-2,3,4,5-tetrahydropyrido[2,3-b][1,4]diazepine.
| Compound Name | 7-(1,4-diazepan-1-yl)-1-methyl-2,3,4,5-tetrahydropyrido[2,3-b][1,4]diazepine |
|---|---|
| PubChem CID | 144746657 |
| Molecular Formula | C14H23N5 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.20 |
| IUPAC Name | 7-(1,4-diazepan-1-yl)-1-methyl-2,3,4,5-tetrahydropyrido[2,3-b][1,4]diazepine |
| SMILES | CN1CCCNc2nc(N3CCCNCC3)ccc21 |
| InChI | InChI=1S/C14H23N5/c1-18-9-3-7-16-14-12(18)4-5-13(17-14)19-10-2-6-15-8-11-19/h4-5,15H,2-3,6-11H2,1H3,(H,16,17) |
| InChIKey | LWBOCZZEDINLOH-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 43.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |