C10H11Cl4N3 — CID 4662988
1-(2,3,5,6-tetrachloro-4-pyridinyl)-1,4-diazepane (PubChem CID 4662988) has the molecular formula C10H11Cl4N3 and a molecular weight of 315.03 g/mol. Its IUPAC name is 1-(2,3,5,6-tetrachloro-4-pyridinyl)-1,4-diazepane.
| Compound Name | 1-(2,3,5,6-tetrachloro-4-pyridinyl)-1,4-diazepane |
|---|---|
| PubChem CID | 4662988 |
| Molecular Formula | C10H11Cl4N3 |
| Molecular Weight | 315.03 g/mol |
| Exact Mass | 312.97 |
| IUPAC Name | 1-(2,3,5,6-tetrachloro-4-pyridinyl)-1,4-diazepane |
| SMILES | Clc1nc(Cl)c(Cl)c(N2CCCNCC2)c1Cl |
| InChI | InChI=1S/C10H11Cl4N3/c11-6-8(7(12)10(14)16-9(6)13)17-4-1-2-15-3-5-17/h15H,1-5H2 |
| InChIKey | RWKFOYUYYFIFBW-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.03 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|