C14H18F4N4 — CID 74891876
1-(2,3,5,6-tetrafluoro-4-piperazin-1-ylphenyl)piperazine (PubChem CID 74891876) has the molecular formula C14H18F4N4 and a molecular weight of 318.32 g/mol. Its IUPAC name is 1-(2,3,5,6-tetrafluoro-4-piperazin-1-ylphenyl)piperazine.
| Compound Name | 1-(2,3,5,6-tetrafluoro-4-piperazin-1-ylphenyl)piperazine |
|---|---|
| PubChem CID | 74891876 |
| Molecular Formula | C14H18F4N4 |
| Molecular Weight | 318.32 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 1-(2,3,5,6-tetrafluoro-4-piperazin-1-ylphenyl)piperazine |
| SMILES | Fc1c(F)c(N2CCNCC2)c(F)c(F)c1N1CCNCC1 |
| InChI | InChI=1S/C14H18F4N4/c15-9-11(17)14(22-7-3-20-4-8-22)12(18)10(16)13(9)21-5-1-19-2-6-21/h19-20H,1-8H2 |
| InChIKey | LRTCJFIHCNYPQX-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.32 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|