C12H14F2N2O — CID 84800463
1-(4,6-difluoro-2,3-dihydro-1-benzofuran-5-yl)piperazine (PubChem CID 84800463) has the molecular formula C12H14F2N2O and a molecular weight of 240.25 g/mol. Its IUPAC name is 1-(4,6-difluoro-2,3-dihydro-1-benzofuran-5-yl)piperazine.
| Compound Name | 1-(4,6-difluoro-2,3-dihydro-1-benzofuran-5-yl)piperazine |
|---|---|
| PubChem CID | 84800463 |
| Molecular Formula | C12H14F2N2O |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 1-(4,6-difluoro-2,3-dihydro-1-benzofuran-5-yl)piperazine |
| SMILES | Fc1cc2c(c(F)c1N1CCNCC1)CCO2 |
| InChI | InChI=1S/C12H14F2N2O/c13-9-7-10-8(1-6-17-10)11(14)12(9)16-4-2-15-3-5-16/h7,15H,1-6H2 |
| InChIKey | ZMFHSTBKXQSSJQ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|