C9H13Cl2N5 — CID 57443710
4,5-dichloro-N-methyl-6-piperazin-1-ylpyrimidin-2-amine (PubChem CID 57443710) has the molecular formula C9H13Cl2N5 and a molecular weight of 262.14 g/mol. Its IUPAC name is 4,5-dichloro-N-methyl-6-piperazin-1-ylpyrimidin-2-amine.
| Compound Name | 4,5-dichloro-N-methyl-6-piperazin-1-ylpyrimidin-2-amine |
|---|---|
| PubChem CID | 57443710 |
| Molecular Formula | C9H13Cl2N5 |
| Molecular Weight | 262.14 g/mol |
| Exact Mass | 261.05 |
| IUPAC Name | 4,5-dichloro-N-methyl-6-piperazin-1-ylpyrimidin-2-amine |
| SMILES | CNc1nc(Cl)c(Cl)c(N2CCNCC2)n1 |
| InChI | InChI=1S/C9H13Cl2N5/c1-12-9-14-7(11)6(10)8(15-9)16-4-2-13-3-5-16/h13H,2-5H2,1H3,(H,12,14,15) |
| InChIKey | PCPZSGSMCOMTMX-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.14 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |