C17H24ClN7 — CID 163596242
4-chloro-N-methyl-6,7-di(piperidin-1-yl)pteridin-2-amine (PubChem CID 163596242) has the molecular formula C17H24ClN7 and a molecular weight of 361.88 g/mol. Its IUPAC name is 4-chloro-N-methyl-6,7-di(piperidin-1-yl)pteridin-2-amine.
| Compound Name | 4-chloro-N-methyl-6,7-di(piperidin-1-yl)pteridin-2-amine |
|---|---|
| PubChem CID | 163596242 |
| Molecular Formula | C17H24ClN7 |
| Molecular Weight | 361.88 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | 4-chloro-N-methyl-6,7-di(piperidin-1-yl)pteridin-2-amine |
| SMILES | CNc1nc(Cl)c2nc(N3CCCCC3)c(N3CCCCC3)nc2n1 |
| InChI | InChI=1S/C17H24ClN7/c1-19-17-21-13(18)12-14(23-17)22-16(25-10-6-3-7-11-25)15(20-12)24-8-4-2-5-9-24/h2-11H2,1H3,(H,19,21,22,23) |
| InChIKey | GTRJENQOSJHAJA-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.88 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |