C9H13Cl2N5 — CID 87183221
(4,5-dichloro-6-piperazin-1-ylpyrimidin-2-yl)methanamine (PubChem CID 87183221) has the molecular formula C9H13Cl2N5 and a molecular weight of 262.14 g/mol. Its IUPAC name is (4,5-dichloro-6-piperazin-1-ylpyrimidin-2-yl)methanamine.
| Compound Name | (4,5-dichloro-6-piperazin-1-ylpyrimidin-2-yl)methanamine |
|---|---|
| PubChem CID | 87183221 |
| Molecular Formula | C9H13Cl2N5 |
| Molecular Weight | 262.14 g/mol |
| Exact Mass | 261.05 |
| IUPAC Name | (4,5-dichloro-6-piperazin-1-ylpyrimidin-2-yl)methanamine |
| SMILES | NCc1nc(Cl)c(Cl)c(N2CCNCC2)n1 |
| InChI | InChI=1S/C9H13Cl2N5/c10-7-8(11)14-6(5-12)15-9(7)16-3-1-13-2-4-16/h13H,1-5,12H2 |
| InChIKey | XRJWUXGYPKMRJU-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.14 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |