C17H24ClN5 — CID 166485360
N'-(3-chloro-2-piperazin-1-ylquinolin-6-yl)butane-1,4-diamine (PubChem CID 166485360) has the molecular formula C17H24ClN5 and a molecular weight of 333.87 g/mol. Its IUPAC name is N'-(3-chloro-2-piperazin-1-ylquinolin-6-yl)butane-1,4-diamine.
| Compound Name | N'-(3-chloro-2-piperazin-1-ylquinolin-6-yl)butane-1,4-diamine |
|---|---|
| PubChem CID | 166485360 |
| Molecular Formula | C17H24ClN5 |
| Molecular Weight | 333.87 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | N'-(3-chloro-2-piperazin-1-ylquinolin-6-yl)butane-1,4-diamine |
| SMILES | NCCCCNc1ccc2nc(N3CCNCC3)c(Cl)cc2c1 |
| InChI | InChI=1S/C17H24ClN5/c18-15-12-13-11-14(21-6-2-1-5-19)3-4-16(13)22-17(15)23-9-7-20-8-10-23/h3-4,11-12,20-21H,1-2,5-10,19H2 |
| InChIKey | TWPUIXCMKZFPKO-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 66.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.87 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|