C18H26Cl3N5 — CID 171851681
[1-(3-chloro-2-piperazin-1-ylquinolin-6-yl)pyrrolidin-3-yl]methanamine;dihydrochloride (PubChem CID 171851681) has the molecular formula C18H26Cl3N5 and a molecular weight of 418.80 g/mol. Its IUPAC name is [1-(3-chloro-2-piperazin-1-ylquinolin-6-yl)pyrrolidin-3-yl]methanamine;dihydrochloride.
| Compound Name | [1-(3-chloro-2-piperazin-1-ylquinolin-6-yl)pyrrolidin-3-yl]methanamine;dihydrochloride |
|---|---|
| PubChem CID | 171851681 |
| Molecular Formula | C18H26Cl3N5 |
| Molecular Weight | 418.80 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | [1-(3-chloro-2-piperazin-1-ylquinolin-6-yl)pyrrolidin-3-yl]methanamine;dihydrochloride |
| SMILES | Cl.Cl.NCC1CCN(c2ccc3nc(N4CCNCC4)c(Cl)cc3c2)C1 |
| InChI | InChI=1S/C18H24ClN5.2ClH/c19-16-10-14-9-15(24-6-3-13(11-20)12-24)1-2-17(14)22-18(16)23-7-4-21-5-8-23;;/h1-2,9-10,13,21H,3-8,11-12,20H2;2*1H |
| InChIKey | APBIALFJTVKMJW-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 57.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.80 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |