C17H24Cl3N5 — CID 166485583
(3R)-1-(3-chloro-2-piperazin-1-ylquinolin-6-yl)pyrrolidin-3-amine;dihydrochloride (PubChem CID 166485583) has the molecular formula C17H24Cl3N5 and a molecular weight of 404.77 g/mol. Its IUPAC name is (3R)-1-(3-chloro-2-piperazin-1-ylquinolin-6-yl)pyrrolidin-3-amine;dihydrochloride.
| Compound Name | (3R)-1-(3-chloro-2-piperazin-1-ylquinolin-6-yl)pyrrolidin-3-amine;dihydrochloride |
|---|---|
| PubChem CID | 166485583 |
| Molecular Formula | C17H24Cl3N5 |
| Molecular Weight | 404.77 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | (3R)-1-(3-chloro-2-piperazin-1-ylquinolin-6-yl)pyrrolidin-3-amine;dihydrochloride |
| SMILES | Cl.Cl.N[C@@H]1CCN(c2ccc3nc(N4CCNCC4)c(Cl)cc3c2)C1 |
| InChI | InChI=1S/C17H22ClN5.2ClH/c18-15-10-12-9-14(23-6-3-13(19)11-23)1-2-16(12)21-17(15)22-7-4-20-5-8-22;;/h1-2,9-10,13,20H,3-8,11,19H2;2*1H/t13-;;/m1../s1 |
| InChIKey | SPRIBYCIBPGKHL-FFXKMJQXSA-N |
| XLogP | 2.68 |
| TPSA | 57.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.77 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |