C21H25Cl3N4 — CID 166485443
[3-(3-chloro-2-piperazin-1-ylquinolin-6-yl)-2-methylphenyl]methanamine;dihydrochloride (PubChem CID 166485443) has the molecular formula C21H25Cl3N4 and a molecular weight of 439.82 g/mol. Its IUPAC name is [3-(3-chloro-2-piperazin-1-ylquinolin-6-yl)-2-methylphenyl]methanamine;dihydrochloride.
| Compound Name | [3-(3-chloro-2-piperazin-1-ylquinolin-6-yl)-2-methylphenyl]methanamine;dihydrochloride |
|---|---|
| PubChem CID | 166485443 |
| Molecular Formula | C21H25Cl3N4 |
| Molecular Weight | 439.82 g/mol |
| Exact Mass | 438.11 |
| IUPAC Name | [3-(3-chloro-2-piperazin-1-ylquinolin-6-yl)-2-methylphenyl]methanamine;dihydrochloride |
| SMILES | Cc1c(CN)cccc1-c1ccc2nc(N3CCNCC3)c(Cl)cc2c1.Cl.Cl |
| InChI | InChI=1S/C21H23ClN4.2ClH/c1-14-16(13-23)3-2-4-18(14)15-5-6-20-17(11-15)12-19(22)21(25-20)26-9-7-24-8-10-26;;/h2-6,11-12,24H,7-10,13,23H2,1H3;2*1H |
| InChIKey | QZVFIPRFEZCBOQ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.82 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |