C18H24ClN5 — CID 166485264
3-chloro-2-piperazin-1-yl-N-[(3S)-piperidin-3-yl]quinolin-6-amine (PubChem CID 166485264) has the molecular formula C18H24ClN5 and a molecular weight of 345.88 g/mol. Its IUPAC name is 3-chloro-2-piperazin-1-yl-N-[(3S)-piperidin-3-yl]quinolin-6-amine.
| Compound Name | 3-chloro-2-piperazin-1-yl-N-[(3S)-piperidin-3-yl]quinolin-6-amine |
|---|---|
| PubChem CID | 166485264 |
| Molecular Formula | C18H24ClN5 |
| Molecular Weight | 345.88 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 3-chloro-2-piperazin-1-yl-N-[(3S)-piperidin-3-yl]quinolin-6-amine |
| SMILES | Clc1cc2cc(N[C@H]3CCCNC3)ccc2nc1N1CCNCC1 |
| InChI | InChI=1S/C18H24ClN5/c19-16-11-13-10-14(22-15-2-1-5-21-12-15)3-4-17(13)23-18(16)24-8-6-20-7-9-24/h3-4,10-11,15,20-22H,1-2,5-9,12H2/t15-/m0/s1 |
| InChIKey | GLRJPLHAKBPVLE-HNNXBMFYSA-N |
| XLogP | 2.46 |
| TPSA | 52.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.88 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |