C32H46N8 — CID 171470095
N'-[3-[[2,6-bis(4-piperazin-1-ylphenyl)-4-pyridinyl]amino]propyl]-N'-methylpropane-1,3-diamine (PubChem CID 171470095) has the molecular formula C32H46N8 and a molecular weight of 542.78 g/mol. Its IUPAC name is N'-[3-[[2,6-bis(4-piperazin-1-ylphenyl)-4-pyridinyl]amino]propyl]-N'-methylpropane-1,3-diamine.
| Compound Name | N'-[3-[[2,6-bis(4-piperazin-1-ylphenyl)-4-pyridinyl]amino]propyl]-N'-methylpropane-1,3-diamine |
|---|---|
| PubChem CID | 171470095 |
| Molecular Formula | C32H46N8 |
| Molecular Weight | 542.78 g/mol |
| Exact Mass | 542.38 |
| IUPAC Name | N'-[3-[[2,6-bis(4-piperazin-1-ylphenyl)-4-pyridinyl]amino]propyl]-N'-methylpropane-1,3-diamine |
| SMILES | CN(CCCN)CCCNc1cc(-c2ccc(N3CCNCC3)cc2)nc(-c2ccc(N3CCNCC3)cc2)c1 |
| InChI | InChI=1S/C32H46N8/c1-38(18-2-12-33)19-3-13-36-28-24-31(26-4-8-29(9-5-26)39-20-14-34-15-21-39)37-32(25-28)27-6-10-30(11-7-27)40-22-16-35-17-23-40/h4-11,24-25,34-35H,2-3,12-23,33H2,1H3,(H,36,37) |
| InChIKey | AMTVGFVYAYFGNY-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 84.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.78 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|