C28H37F3N6O2 — CID 175736475
N'-methyl-N'-[3-[[2-(4-piperazin-1-ylphenyl)quinolin-4-yl]amino]propyl]propane-1,3-diamine;2,2,2-trifluoroacetic acid (PubChem CID 175736475) has the molecular formula C28H37F3N6O2 and a molecular weight of 546.64 g/mol. Its IUPAC name is N'-methyl-N'-[3-[[2-(4-piperazin-1-ylphenyl)quinolin-4-yl]amino]propyl]propane-1,3-diamine;2,2,2-trifluoroacetic acid.
| Compound Name | N'-methyl-N'-[3-[[2-(4-piperazin-1-ylphenyl)quinolin-4-yl]amino]propyl]propane-1,3-diamine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 175736475 |
| Molecular Formula | C28H37F3N6O2 |
| Molecular Weight | 546.64 g/mol |
| Exact Mass | 546.29 |
| IUPAC Name | N'-methyl-N'-[3-[[2-(4-piperazin-1-ylphenyl)quinolin-4-yl]amino]propyl]propane-1,3-diamine;2,2,2-trifluoroacetic acid |
| SMILES | CN(CCCN)CCCNc1cc(-c2ccc(N3CCNCC3)cc2)nc2ccccc12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C26H36N6.C2HF3O2/c1-31(16-4-12-27)17-5-13-29-26-20-25(30-24-7-3-2-6-23(24)26)21-8-10-22(11-9-21)32-18-14-28-15-19-32;3-2(4,5)1(6)7/h2-3,6-11,20,28H,4-5,12-19,27H2,1H3,(H,29,30);(H,6,7) |
| InChIKey | ISEFMOQDNSQFLA-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 106.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.64 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|