C25H32ClN5O — CID 163296830
4-[4-[4-[3-(dimethylamino)propylamino]quinolin-2-yl]phenyl]-1-methylpiperazin-2-one;hydrochloride (PubChem CID 163296830) has the molecular formula C25H32ClN5O and a molecular weight of 454.02 g/mol. Its IUPAC name is 4-[4-[4-[3-(dimethylamino)propylamino]quinolin-2-yl]phenyl]-1-methylpiperazin-2-one;hydrochloride.
| Compound Name | 4-[4-[4-[3-(dimethylamino)propylamino]quinolin-2-yl]phenyl]-1-methylpiperazin-2-one;hydrochloride |
|---|---|
| PubChem CID | 163296830 |
| Molecular Formula | C25H32ClN5O |
| Molecular Weight | 454.02 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | 4-[4-[4-[3-(dimethylamino)propylamino]quinolin-2-yl]phenyl]-1-methylpiperazin-2-one;hydrochloride |
| SMILES | CN(C)CCCNc1cc(-c2ccc(N3CCN(C)C(=O)C3)cc2)nc2ccccc12.Cl |
| InChI | InChI=1S/C25H31N5O.ClH/c1-28(2)14-6-13-26-24-17-23(27-22-8-5-4-7-21(22)24)19-9-11-20(12-10-19)30-16-15-29(3)25(31)18-30;/h4-5,7-12,17H,6,13-16,18H2,1-3H3,(H,26,27);1H |
| InChIKey | KHYBFHQSZUAAMG-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 51.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.02 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|