C28H38N6O2 — CID 177172655
tert-butyl 4-[5-[4-[3-(dimethylamino)propylamino]quinolin-2-yl]-2-pyridinyl]piperazine-1-carboxylate (PubChem CID 177172655) has the molecular formula C28H38N6O2 and a molecular weight of 490.65 g/mol. Its IUPAC name is tert-butyl 4-[5-[4-[3-(dimethylamino)propylamino]quinolin-2-yl]-2-pyridinyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[5-[4-[3-(dimethylamino)propylamino]quinolin-2-yl]-2-pyridinyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 177172655 |
| Molecular Formula | C28H38N6O2 |
| Molecular Weight | 490.65 g/mol |
| Exact Mass | 490.31 |
| IUPAC Name | tert-butyl 4-[5-[4-[3-(dimethylamino)propylamino]quinolin-2-yl]-2-pyridinyl]piperazine-1-carboxylate |
| SMILES | CN(C)CCCNc1cc(-c2ccc(N3CCN(C(=O)OC(C)(C)C)CC3)nc2)nc2ccccc12 |
| InChI | InChI=1S/C28H38N6O2/c1-28(2,3)36-27(35)34-17-15-33(16-18-34)26-12-11-21(20-30-26)24-19-25(29-13-8-14-32(4)5)22-9-6-7-10-23(22)31-24/h6-7,9-12,19-20H,8,13-18H2,1-5H3,(H,29,31) |
| InChIKey | OCLGXHHEJXEAPC-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.65 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|