C11H15BrN4O — CID 114694720
4-bromo-2-methyl-5-(1,2,3,6-tetrahydropyridin-4-ylmethylamino)pyridazin-3-one (PubChem CID 114694720) has the molecular formula C11H15BrN4O and a molecular weight of 299.17 g/mol. Its IUPAC name is 4-bromo-2-methyl-5-(1,2,3,6-tetrahydropyridin-4-ylmethylamino)pyridazin-3-one.
| Compound Name | 4-bromo-2-methyl-5-(1,2,3,6-tetrahydropyridin-4-ylmethylamino)pyridazin-3-one |
|---|---|
| PubChem CID | 114694720 |
| Molecular Formula | C11H15BrN4O |
| Molecular Weight | 299.17 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | 4-bromo-2-methyl-5-(1,2,3,6-tetrahydropyridin-4-ylmethylamino)pyridazin-3-one |
| SMILES | Cn1ncc(NCC2=CCNCC2)c(Br)c1=O |
| InChI | InChI=1S/C11H15BrN4O/c1-16-11(17)10(12)9(7-15-16)14-6-8-2-4-13-5-3-8/h2,7,13-14H,3-6H2,1H3 |
| InChIKey | QVZHLPAEIQGQBZ-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.17 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|