C14H16N4 — CID 114697863
N-pyrrolidin-3-yl-1,4-dihydroindeno[2,1-d]pyrazol-3-amine (PubChem CID 114697863) has the molecular formula C14H16N4 and a molecular weight of 240.31 g/mol. Its IUPAC name is N-pyrrolidin-3-yl-1,4-dihydroindeno[2,1-d]pyrazol-3-amine.
| Compound Name | N-pyrrolidin-3-yl-1,4-dihydroindeno[2,1-d]pyrazol-3-amine |
|---|---|
| PubChem CID | 114697863 |
| Molecular Formula | C14H16N4 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | N-pyrrolidin-3-yl-1,4-dihydroindeno[2,1-d]pyrazol-3-amine |
| SMILES | c1ccc2c(c1)Cc1c(NC3CCNC3)n[nH]c1-2 |
| InChI | InChI=1S/C14H16N4/c1-2-4-11-9(3-1)7-12-13(11)17-18-14(12)16-10-5-6-15-8-10/h1-4,10,15H,5-8H2,(H2,16,17,18) |
| InChIKey | NCMULWLLRXYHBW-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 52.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |