C15H20F2N2O2 — CID 114699967
2-(difluoromethoxy)-N-[(3-methylpiperidin-4-yl)methyl]benzamide (PubChem CID 114699967) has the molecular formula C15H20F2N2O2 and a molecular weight of 298.33 g/mol. Its IUPAC name is 2-(difluoromethoxy)-N-[(3-methylpiperidin-4-yl)methyl]benzamide.
| Compound Name | 2-(difluoromethoxy)-N-[(3-methylpiperidin-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 114699967 |
| Molecular Formula | C15H20F2N2O2 |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 2-(difluoromethoxy)-N-[(3-methylpiperidin-4-yl)methyl]benzamide |
| SMILES | CC1CNCCC1CNC(=O)c1ccccc1OC(F)F |
| InChI | InChI=1S/C15H20F2N2O2/c1-10-8-18-7-6-11(10)9-19-14(20)12-4-2-3-5-13(12)21-15(16)17/h2-5,10-11,15,18H,6-9H2,1H3,(H,19,20) |
| InChIKey | SWEFGUWCHFJVKE-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |