C11H11ClFN3O — CID 114704013
2-amino-2-[3-(3-chloro-2-fluorophenyl)imidazol-4-yl]ethanol (PubChem CID 114704013) has the molecular formula C11H11ClFN3O and a molecular weight of 255.68 g/mol. Its IUPAC name is 2-amino-2-[3-(3-chloro-2-fluorophenyl)imidazol-4-yl]ethanol.
| Compound Name | 2-amino-2-[3-(3-chloro-2-fluorophenyl)imidazol-4-yl]ethanol |
|---|---|
| PubChem CID | 114704013 |
| Molecular Formula | C11H11ClFN3O |
| Molecular Weight | 255.68 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | 2-amino-2-[3-(3-chloro-2-fluorophenyl)imidazol-4-yl]ethanol |
| SMILES | NC(CO)c1cncn1-c1cccc(Cl)c1F |
| InChI | InChI=1S/C11H11ClFN3O/c12-7-2-1-3-9(11(7)13)16-6-15-4-10(16)8(14)5-17/h1-4,6,8,17H,5,14H2 |
| InChIKey | VDFZQIMPTZYJTI-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.68 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |