C15H21N3O3 — CID 114703016
2-amino-2-[3-(2,5-diethoxyphenyl)imidazol-4-yl]ethanol (PubChem CID 114703016) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is 2-amino-2-[3-(2,5-diethoxyphenyl)imidazol-4-yl]ethanol.
| Compound Name | 2-amino-2-[3-(2,5-diethoxyphenyl)imidazol-4-yl]ethanol |
|---|---|
| PubChem CID | 114703016 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 2-amino-2-[3-(2,5-diethoxyphenyl)imidazol-4-yl]ethanol |
| SMILES | CCOc1ccc(OCC)c(-n2cncc2C(N)CO)c1 |
| InChI | InChI=1S/C15H21N3O3/c1-3-20-11-5-6-15(21-4-2)13(7-11)18-10-17-8-14(18)12(16)9-19/h5-8,10,12,19H,3-4,9,16H2,1-2H3 |
| InChIKey | PUBNHACHUDYTQG-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |