C14H23N3O2S — CID 114720394
3-[5-(4-methylpiperidin-4-yl)imidazol-1-yl]thiane 1,1-dioxide (PubChem CID 114720394) has the molecular formula C14H23N3O2S and a molecular weight of 297.42 g/mol. Its IUPAC name is 3-[5-(4-methylpiperidin-4-yl)imidazol-1-yl]thiane 1,1-dioxide.
| Compound Name | 3-[5-(4-methylpiperidin-4-yl)imidazol-1-yl]thiane 1,1-dioxide |
|---|---|
| PubChem CID | 114720394 |
| Molecular Formula | C14H23N3O2S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 3-[5-(4-methylpiperidin-4-yl)imidazol-1-yl]thiane 1,1-dioxide |
| SMILES | CC1(c2cncn2C2CCCS(=O)(=O)C2)CCNCC1 |
| InChI | InChI=1S/C14H23N3O2S/c1-14(4-6-15-7-5-14)13-9-16-11-17(13)12-3-2-8-20(18,19)10-12/h9,11-12,15H,2-8,10H2,1H3 |
| InChIKey | OYASKOOUZLLSKW-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |