C16H11ClF2O2 — CID 114724291
1-(5-chloro-1-benzofuran-2-yl)-1-(3,5-difluorophenyl)ethanol (PubChem CID 114724291) has the molecular formula C16H11ClF2O2 and a molecular weight of 308.71 g/mol. Its IUPAC name is 1-(5-chloro-1-benzofuran-2-yl)-1-(3,5-difluorophenyl)ethanol.
| Compound Name | 1-(5-chloro-1-benzofuran-2-yl)-1-(3,5-difluorophenyl)ethanol |
|---|---|
| PubChem CID | 114724291 |
| Molecular Formula | C16H11ClF2O2 |
| Molecular Weight | 308.71 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | 1-(5-chloro-1-benzofuran-2-yl)-1-(3,5-difluorophenyl)ethanol |
| SMILES | CC(O)(c1cc(F)cc(F)c1)c1cc2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C16H11ClF2O2/c1-16(20,10-6-12(18)8-13(19)7-10)15-5-9-4-11(17)2-3-14(9)21-15/h2-8,20H,1H3 |
| InChIKey | OITDBRGJAGJDRG-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.71 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |